C17H24 — CID 163396253
1-(cyclopropylmethyl)-4-(4-methylcyclohexyl)benzene (PubChem CID 163396253) has the molecular formula C17H24 and a molecular weight of 228.38 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-4-(4-methylcyclohexyl)benzene.
| Compound Name | 1-(cyclopropylmethyl)-4-(4-methylcyclohexyl)benzene |
|---|---|
| PubChem CID | 163396253 |
| Molecular Formula | C17H24 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | 1-(cyclopropylmethyl)-4-(4-methylcyclohexyl)benzene |
| SMILES | CC1CCC(c2ccc(CC3CC3)cc2)CC1 |
| InChI | InChI=1S/C17H24/c1-13-2-8-16(9-3-13)17-10-6-15(7-11-17)12-14-4-5-14/h6-7,10-11,13-14,16H,2-5,8-9,12H2,1H3 |
| InChIKey | MIUYJRJYFPSIAG-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |