About 1,4-bis[(4-methylcyclohexyl)methyl]benzene;ethane
1,4-bis[(4-methylcyclohexyl)methyl]benzene;ethane (PubChem CID 91321679) has the molecular formula C28H52
and a molecular weight of 388.72 g/mol. Its IUPAC name is 1,4-bis[(4-methylcyclohexyl)methyl]benzene;ethane.
Molecular Properties
| Compound Name | 1,4-bis[(4-methylcyclohexyl)methyl]benzene;ethane |
| PubChem CID | 91321679 |
| Molecular Formula | C28H52 |
| Molecular Weight | 388.72 g/mol |
| Exact Mass | 388.41 |
| IUPAC Name | 1,4-bis[(4-methylcyclohexyl)methyl]benzene;ethane |
| SMILES | CC.CC.CC.CC1CCC(Cc2ccc(CC3CCC(C)CC3)cc2)CC1 |
| InChI | InChI=1S/C22H34.3C2H6/c1-17-3-7-19(8-4-17)15-21-11-13-22(14-12-21)16-20-9-5-18(2)6-10-20;3*1-2/h11-14,17-20H,3-10,15-16H2,1-2H3;3*1-2H3 |
| InChIKey | DGWRNXADCZEWAA-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.72 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,4-bis[(4-methylcyclohexyl)methyl]benzene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis[(4-methylcyclohexyl)methyl]benzene;ethane?
The IUPAC name of 1,4-bis[(4-methylcyclohexyl)methyl]benzene;ethane (CID 91321679) is 1,4-bis[(4-methylcyclohexyl)methyl]benzene;ethane.
What is the SMILES notation for 1,4-bis[(4-methylcyclohexyl)methyl]benzene;ethane?
The canonical SMILES for 1,4-bis[(4-methylcyclohexyl)methyl]benzene;ethane is CC.CC.CC.CC1CCC(Cc2ccc(CC3CCC(C)CC3)cc2)CC1.
What is the InChIKey of 1,4-bis[(4-methylcyclohexyl)methyl]benzene;ethane?
The InChIKey is DGWRNXADCZEWAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H34.3C2H6/c1-17-3-7-19(8-4-17)15-21-11-13-22(14-12-21)16-20-9-5-18(2)6-10-20;3*1-2/h11-14,17-20H,3-10,15-16H2,1-2H3;3*1-2H3.
What are the key properties of 1,4-bis[(4-methylcyclohexyl)methyl]benzene;ethane?
1,4-bis[(4-methylcyclohexyl)methyl]benzene;ethane has a molecular weight of 388.72 g/mol, XLogP of 9.50, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis[(4-methylcyclohexyl)methyl]benzene;ethane is sourced from PubChem (CID 91321679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).