C28H52 — CID 91321679
1,4-bis[(4-methylcyclohexyl)methyl]benzene;ethane (PubChem CID 91321679) has the molecular formula C28H52 and a molecular weight of 388.72 g/mol. Its IUPAC name is 1,4-bis[(4-methylcyclohexyl)methyl]benzene;ethane.
| Compound Name | 1,4-bis[(4-methylcyclohexyl)methyl]benzene;ethane |
|---|---|
| PubChem CID | 91321679 |
| Molecular Formula | C28H52 |
| Molecular Weight | 388.72 g/mol |
| Exact Mass | 388.41 |
| IUPAC Name | 1,4-bis[(4-methylcyclohexyl)methyl]benzene;ethane |
| SMILES | CC.CC.CC.CC1CCC(Cc2ccc(CC3CCC(C)CC3)cc2)CC1 |
| InChI | InChI=1S/C22H34.3C2H6/c1-17-3-7-19(8-4-17)15-21-11-13-22(14-12-21)16-20-9-5-18(2)6-10-20;3*1-2/h11-14,17-20H,3-10,15-16H2,1-2H3;3*1-2H3 |
| InChIKey | DGWRNXADCZEWAA-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.72 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |