C22H28 — CID 20579999
1-methyl-4-[2-[4-(4-methylcyclohexyl)phenyl]ethyl]benzene (PubChem CID 20579999) has the molecular formula C22H28 and a molecular weight of 292.47 g/mol. Its IUPAC name is 1-methyl-4-[2-[4-(4-methylcyclohexyl)phenyl]ethyl]benzene.
| Compound Name | 1-methyl-4-[2-[4-(4-methylcyclohexyl)phenyl]ethyl]benzene |
|---|---|
| PubChem CID | 20579999 |
| Molecular Formula | C22H28 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 1-methyl-4-[2-[4-(4-methylcyclohexyl)phenyl]ethyl]benzene |
| SMILES | Cc1ccc(CCc2ccc(C3CCC(C)CC3)cc2)cc1 |
| InChI | InChI=1S/C22H28/c1-17-3-7-19(8-4-17)9-10-20-11-15-22(16-12-20)21-13-5-18(2)6-14-21/h3-4,7-8,11-12,15-16,18,21H,5-6,9-10,13-14H2,1-2H3 |
| InChIKey | DFWNBKSAOMSRNV-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |