C22H36O — CID 54304761
ethane;1-methyl-4-[4-(4-methylcyclohexyl)oxycyclohexyl]benzene (PubChem CID 54304761) has the molecular formula C22H36O and a molecular weight of 316.53 g/mol. Its IUPAC name is ethane;1-methyl-4-[4-(4-methylcyclohexyl)oxycyclohexyl]benzene.
| Compound Name | ethane;1-methyl-4-[4-(4-methylcyclohexyl)oxycyclohexyl]benzene |
|---|---|
| PubChem CID | 54304761 |
| Molecular Formula | C22H36O |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 316.28 |
| IUPAC Name | ethane;1-methyl-4-[4-(4-methylcyclohexyl)oxycyclohexyl]benzene |
| SMILES | CC.Cc1ccc(C2CCC(OC3CCC(C)CC3)CC2)cc1 |
| InChI | InChI=1S/C20H30O.C2H6/c1-15-3-7-17(8-4-15)18-9-13-20(14-10-18)21-19-11-5-16(2)6-12-19;1-2/h3-4,7-8,16,18-20H,5-6,9-14H2,1-2H3;1-2H3 |
| InChIKey | SGSIHCANBPAMCE-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |