C22H26O — CID 59938752
1-[4-(4-methylcyclohexyl)phenyl]-2-(4-methylphenyl)ethanone (PubChem CID 59938752) has the molecular formula C22H26O and a molecular weight of 306.45 g/mol. Its IUPAC name is 1-[4-(4-methylcyclohexyl)phenyl]-2-(4-methylphenyl)ethanone.
| Compound Name | 1-[4-(4-methylcyclohexyl)phenyl]-2-(4-methylphenyl)ethanone |
|---|---|
| PubChem CID | 59938752 |
| Molecular Formula | C22H26O |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | 1-[4-(4-methylcyclohexyl)phenyl]-2-(4-methylphenyl)ethanone |
| SMILES | Cc1ccc(CC(=O)c2ccc(C3CCC(C)CC3)cc2)cc1 |
| InChI | InChI=1S/C22H26O/c1-16-3-7-18(8-4-16)15-22(23)21-13-11-20(12-14-21)19-9-5-17(2)6-10-19/h3-4,7-8,11-14,17,19H,5-6,9-10,15H2,1-2H3 |
| InChIKey | FZBFYWNMLIUWFF-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |