C22H27F — CID 20599389
2-fluoro-1-methyl-4-[2-[4-(4-methylcyclohexyl)phenyl]ethyl]benzene (PubChem CID 20599389) has the molecular formula C22H27F and a molecular weight of 310.46 g/mol. Its IUPAC name is 2-fluoro-1-methyl-4-[2-[4-(4-methylcyclohexyl)phenyl]ethyl]benzene.
| Compound Name | 2-fluoro-1-methyl-4-[2-[4-(4-methylcyclohexyl)phenyl]ethyl]benzene |
|---|---|
| PubChem CID | 20599389 |
| Molecular Formula | C22H27F |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | 2-fluoro-1-methyl-4-[2-[4-(4-methylcyclohexyl)phenyl]ethyl]benzene |
| SMILES | Cc1ccc(CCc2ccc(C3CCC(C)CC3)cc2)cc1F |
| InChI | InChI=1S/C22H27F/c1-16-3-11-20(12-4-16)21-13-9-18(10-14-21)7-8-19-6-5-17(2)22(23)15-19/h5-6,9-10,13-16,20H,3-4,7-8,11-12H2,1-2H3 |
| InChIKey | TYPGMCXMRZYJCM-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |