C21H26ClFSi — CID 137327410
[4-[4-[2-(4-chloro-3-fluorophenyl)ethyl]phenyl]cyclohexyl]-methylsilane (PubChem CID 137327410) has the molecular formula C21H26ClFSi and a molecular weight of 360.98 g/mol. Its IUPAC name is [4-[4-[2-(4-chloro-3-fluorophenyl)ethyl]phenyl]cyclohexyl]-methylsilane.
| Compound Name | [4-[4-[2-(4-chloro-3-fluorophenyl)ethyl]phenyl]cyclohexyl]-methylsilane |
|---|---|
| PubChem CID | 137327410 |
| Molecular Formula | C21H26ClFSi |
| Molecular Weight | 360.98 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | [4-[4-[2-(4-chloro-3-fluorophenyl)ethyl]phenyl]cyclohexyl]-methylsilane |
| SMILES | C[SiH2]C1CCC(c2ccc(CCc3ccc(Cl)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C21H26ClFSi/c1-24-19-11-9-18(10-12-19)17-7-4-15(5-8-17)2-3-16-6-13-20(22)21(23)14-16/h4-8,13-14,18-19H,2-3,9-12,24H2,1H3 |
| InChIKey | SGTQBWNKCQJSKQ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.98 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|