C17H16ClFO — CID 107883644
2-(4-chloro-3-fluorophenyl)-1-(4-cyclopropylphenyl)ethanol (PubChem CID 107883644) has the molecular formula C17H16ClFO and a molecular weight of 290.77 g/mol. Its IUPAC name is 2-(4-chloro-3-fluorophenyl)-1-(4-cyclopropylphenyl)ethanol.
| Compound Name | 2-(4-chloro-3-fluorophenyl)-1-(4-cyclopropylphenyl)ethanol |
|---|---|
| PubChem CID | 107883644 |
| Molecular Formula | C17H16ClFO |
| Molecular Weight | 290.77 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 2-(4-chloro-3-fluorophenyl)-1-(4-cyclopropylphenyl)ethanol |
| SMILES | OC(Cc1ccc(Cl)c(F)c1)c1ccc(C2CC2)cc1 |
| InChI | InChI=1S/C17H16ClFO/c18-15-8-1-11(9-16(15)19)10-17(20)14-6-4-13(5-7-14)12-2-3-12/h1,4-9,12,17,20H,2-3,10H2 |
| InChIKey | FOXHQAGYZRZFJL-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.77 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |