C18H19FO2 — CID 79973379
1-(4-cyclopropylphenyl)-2-(3-fluoro-4-methoxyphenyl)ethanol (PubChem CID 79973379) has the molecular formula C18H19FO2 and a molecular weight of 286.35 g/mol. Its IUPAC name is 1-(4-cyclopropylphenyl)-2-(3-fluoro-4-methoxyphenyl)ethanol.
| Compound Name | 1-(4-cyclopropylphenyl)-2-(3-fluoro-4-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 79973379 |
| Molecular Formula | C18H19FO2 |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 1-(4-cyclopropylphenyl)-2-(3-fluoro-4-methoxyphenyl)ethanol |
| SMILES | COc1ccc(CC(O)c2ccc(C3CC3)cc2)cc1F |
| InChI | InChI=1S/C18H19FO2/c1-21-18-9-2-12(10-16(18)19)11-17(20)15-7-5-14(6-8-15)13-3-4-13/h2,5-10,13,17,20H,3-4,11H2,1H3 |
| InChIKey | LVCLYHRCUKNTIZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |