C13H12BrFO2S — CID 105084452
1-(5-bromothiophen-3-yl)-2-(3-fluoro-4-methoxyphenyl)ethanol (PubChem CID 105084452) has the molecular formula C13H12BrFO2S and a molecular weight of 331.21 g/mol. Its IUPAC name is 1-(5-bromothiophen-3-yl)-2-(3-fluoro-4-methoxyphenyl)ethanol.
| Compound Name | 1-(5-bromothiophen-3-yl)-2-(3-fluoro-4-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 105084452 |
| Molecular Formula | C13H12BrFO2S |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | 1-(5-bromothiophen-3-yl)-2-(3-fluoro-4-methoxyphenyl)ethanol |
| SMILES | COc1ccc(CC(O)c2csc(Br)c2)cc1F |
| InChI | InChI=1S/C13H12BrFO2S/c1-17-12-3-2-8(4-10(12)15)5-11(16)9-6-13(14)18-7-9/h2-4,6-7,11,16H,5H2,1H3 |
| InChIKey | UAFSRMLCCDEVRL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |