C13H12Br2O2S — CID 105081985
2-(5-bromo-2-methoxyphenyl)-1-(5-bromothiophen-3-yl)ethanol (PubChem CID 105081985) has the molecular formula C13H12Br2O2S and a molecular weight of 392.11 g/mol. Its IUPAC name is 2-(5-bromo-2-methoxyphenyl)-1-(5-bromothiophen-3-yl)ethanol.
| Compound Name | 2-(5-bromo-2-methoxyphenyl)-1-(5-bromothiophen-3-yl)ethanol |
|---|---|
| PubChem CID | 105081985 |
| Molecular Formula | C13H12Br2O2S |
| Molecular Weight | 392.11 g/mol |
| Exact Mass | 389.89 |
| IUPAC Name | 2-(5-bromo-2-methoxyphenyl)-1-(5-bromothiophen-3-yl)ethanol |
| SMILES | COc1ccc(Br)cc1CC(O)c1csc(Br)c1 |
| InChI | InChI=1S/C13H12Br2O2S/c1-17-12-3-2-10(14)4-8(12)5-11(16)9-6-13(15)18-7-9/h2-4,6-7,11,16H,5H2,1H3 |
| InChIKey | KLZCUYLBLAHLHM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.11 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |