C15H17BrO2S — CID 63893813
2-(5-bromo-2-methoxyphenyl)-1-(5-ethylthiophen-2-yl)ethanol (PubChem CID 63893813) has the molecular formula C15H17BrO2S and a molecular weight of 341.27 g/mol. Its IUPAC name is 2-(5-bromo-2-methoxyphenyl)-1-(5-ethylthiophen-2-yl)ethanol.
| Compound Name | 2-(5-bromo-2-methoxyphenyl)-1-(5-ethylthiophen-2-yl)ethanol |
|---|---|
| PubChem CID | 63893813 |
| Molecular Formula | C15H17BrO2S |
| Molecular Weight | 341.27 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | 2-(5-bromo-2-methoxyphenyl)-1-(5-ethylthiophen-2-yl)ethanol |
| SMILES | CCc1ccc(C(O)Cc2cc(Br)ccc2OC)s1 |
| InChI | InChI=1S/C15H17BrO2S/c1-3-12-5-7-15(19-12)13(17)9-10-8-11(16)4-6-14(10)18-2/h4-8,13,17H,3,9H2,1-2H3 |
| InChIKey | UQAZJSLDKXBSAR-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.27 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |