C17H25FO3 — CID 116754525
2-(3-fluoro-4-methoxyphenyl)-1-(1-methoxy-4-methylcyclohexyl)ethanol (PubChem CID 116754525) has the molecular formula C17H25FO3 and a molecular weight of 296.38 g/mol. Its IUPAC name is 2-(3-fluoro-4-methoxyphenyl)-1-(1-methoxy-4-methylcyclohexyl)ethanol.
| Compound Name | 2-(3-fluoro-4-methoxyphenyl)-1-(1-methoxy-4-methylcyclohexyl)ethanol |
|---|---|
| PubChem CID | 116754525 |
| Molecular Formula | C17H25FO3 |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 2-(3-fluoro-4-methoxyphenyl)-1-(1-methoxy-4-methylcyclohexyl)ethanol |
| SMILES | COc1ccc(CC(O)C2(OC)CCC(C)CC2)cc1F |
| InChI | InChI=1S/C17H25FO3/c1-12-6-8-17(21-3,9-7-12)16(19)11-13-4-5-15(20-2)14(18)10-13/h4-5,10,12,16,19H,6-9,11H2,1-3H3 |
| InChIKey | WWHIUMJPFSRWOZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |