C16H22F2O2 — CID 116755817
2-(3,4-difluorophenyl)-1-(1-methoxycycloheptyl)ethanol (PubChem CID 116755817) has the molecular formula C16H22F2O2 and a molecular weight of 284.35 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-1-(1-methoxycycloheptyl)ethanol.
| Compound Name | 2-(3,4-difluorophenyl)-1-(1-methoxycycloheptyl)ethanol |
|---|---|
| PubChem CID | 116755817 |
| Molecular Formula | C16H22F2O2 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 2-(3,4-difluorophenyl)-1-(1-methoxycycloheptyl)ethanol |
| SMILES | COC1(C(O)Cc2ccc(F)c(F)c2)CCCCCC1 |
| InChI | InChI=1S/C16H22F2O2/c1-20-16(8-4-2-3-5-9-16)15(19)11-12-6-7-13(17)14(18)10-12/h6-7,10,15,19H,2-5,8-9,11H2,1H3 |
| InChIKey | YRTZMIQYUPQLNG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |