C16H23F2NO — CID 82920040
2-(3,4-difluorophenyl)-1-[1-(dimethylamino)cyclohexyl]ethanol (PubChem CID 82920040) has the molecular formula C16H23F2NO and a molecular weight of 283.36 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-1-[1-(dimethylamino)cyclohexyl]ethanol.
| Compound Name | 2-(3,4-difluorophenyl)-1-[1-(dimethylamino)cyclohexyl]ethanol |
|---|---|
| PubChem CID | 82920040 |
| Molecular Formula | C16H23F2NO |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 2-(3,4-difluorophenyl)-1-[1-(dimethylamino)cyclohexyl]ethanol |
| SMILES | CN(C)C1(C(O)Cc2ccc(F)c(F)c2)CCCCC1 |
| InChI | InChI=1S/C16H23F2NO/c1-19(2)16(8-4-3-5-9-16)15(20)11-12-6-7-13(17)14(18)10-12/h6-7,10,15,20H,3-5,8-9,11H2,1-2H3 |
| InChIKey | KIERCAMFHLNYEY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |