C16H22ClFO2 — CID 103039723
2-(3-chloro-4-fluorophenyl)-1-(1-methoxy-4-methylcyclohexyl)ethanol (PubChem CID 103039723) has the molecular formula C16H22ClFO2 and a molecular weight of 300.80 g/mol. Its IUPAC name is 2-(3-chloro-4-fluorophenyl)-1-(1-methoxy-4-methylcyclohexyl)ethanol.
| Compound Name | 2-(3-chloro-4-fluorophenyl)-1-(1-methoxy-4-methylcyclohexyl)ethanol |
|---|---|
| PubChem CID | 103039723 |
| Molecular Formula | C16H22ClFO2 |
| Molecular Weight | 300.80 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 2-(3-chloro-4-fluorophenyl)-1-(1-methoxy-4-methylcyclohexyl)ethanol |
| SMILES | COC1(C(O)Cc2ccc(F)c(Cl)c2)CCC(C)CC1 |
| InChI | InChI=1S/C16H22ClFO2/c1-11-5-7-16(20-2,8-6-11)15(19)10-12-3-4-14(18)13(17)9-12/h3-4,9,11,15,19H,5-8,10H2,1-2H3 |
| InChIKey | RYSXHMQNPIDDJV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.80 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |