C17H16F2O — CID 114931089
1-(4-cyclopropylphenyl)-2-(2,6-difluorophenyl)ethanol (PubChem CID 114931089) has the molecular formula C17H16F2O and a molecular weight of 274.31 g/mol. Its IUPAC name is 1-(4-cyclopropylphenyl)-2-(2,6-difluorophenyl)ethanol.
| Compound Name | 1-(4-cyclopropylphenyl)-2-(2,6-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 114931089 |
| Molecular Formula | C17H16F2O |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 1-(4-cyclopropylphenyl)-2-(2,6-difluorophenyl)ethanol |
| SMILES | OC(Cc1c(F)cccc1F)c1ccc(C2CC2)cc1 |
| InChI | InChI=1S/C17H16F2O/c18-15-2-1-3-16(19)14(15)10-17(20)13-8-6-12(7-9-13)11-4-5-11/h1-3,6-9,11,17,20H,4-5,10H2 |
| InChIKey | ZDKKATKTBPQCKM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |