C27H34F4 — CID 22373784
2-fluoro-4-[2-[4-[4-(3-methylpentyl)cyclohexyl]phenyl]ethyl]-1-(trifluoromethyl)benzene (PubChem CID 22373784) has the molecular formula C27H34F4 and a molecular weight of 434.56 g/mol. Its IUPAC name is 2-fluoro-4-[2-[4-[4-(3-methylpentyl)cyclohexyl]phenyl]ethyl]-1-(trifluoromethyl)benzene.
| Compound Name | 2-fluoro-4-[2-[4-[4-(3-methylpentyl)cyclohexyl]phenyl]ethyl]-1-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 22373784 |
| Molecular Formula | C27H34F4 |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | 2-fluoro-4-[2-[4-[4-(3-methylpentyl)cyclohexyl]phenyl]ethyl]-1-(trifluoromethyl)benzene |
| SMILES | CCC(C)CCC1CCC(c2ccc(CCc3ccc(C(F)(F)F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C27H34F4/c1-3-19(2)4-5-20-8-13-23(14-9-20)24-15-10-21(11-16-24)6-7-22-12-17-25(26(28)18-22)27(29,30)31/h10-12,15-20,23H,3-9,13-14H2,1-2H3 |
| InChIKey | ZPBSJJDKIFMEAG-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |