C27H33F5 — CID 22437512
2-fluoro-1-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethyl]-4-(4-hexylcyclohexyl)benzene (PubChem CID 22437512) has the molecular formula C27H33F5 and a molecular weight of 452.55 g/mol. Its IUPAC name is 2-fluoro-1-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethyl]-4-(4-hexylcyclohexyl)benzene.
| Compound Name | 2-fluoro-1-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethyl]-4-(4-hexylcyclohexyl)benzene |
|---|---|
| PubChem CID | 22437512 |
| Molecular Formula | C27H33F5 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | 2-fluoro-1-[2-[3-fluoro-4-(trifluoromethyl)phenyl]ethyl]-4-(4-hexylcyclohexyl)benzene |
| SMILES | CCCCCCC1CCC(c2ccc(CCc3ccc(C(F)(F)F)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C27H33F5/c1-2-3-4-5-6-19-7-11-21(12-8-19)23-15-14-22(25(28)18-23)13-9-20-10-16-24(26(29)17-20)27(30,31)32/h10,14-19,21H,2-9,11-13H2,1H3 |
| InChIKey | SSJGYRQPJWSPMS-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|