C33H44ClF3 — CID 54379850
2-chloro-1,3-difluoro-5-[2-[2-fluoro-4-[4-[2-(4-pentylcyclohexyl)ethyl]cyclohexyl]phenyl]ethyl]benzene (PubChem CID 54379850) has the molecular formula C33H44ClF3 and a molecular weight of 533.16 g/mol. Its IUPAC name is 2-chloro-1,3-difluoro-5-[2-[2-fluoro-4-[4-[2-(4-pentylcyclohexyl)ethyl]cyclohexyl]phenyl]ethyl]benzene.
| Compound Name | 2-chloro-1,3-difluoro-5-[2-[2-fluoro-4-[4-[2-(4-pentylcyclohexyl)ethyl]cyclohexyl]phenyl]ethyl]benzene |
|---|---|
| PubChem CID | 54379850 |
| Molecular Formula | C33H44ClF3 |
| Molecular Weight | 533.16 g/mol |
| Exact Mass | 532.31 |
| IUPAC Name | 2-chloro-1,3-difluoro-5-[2-[2-fluoro-4-[4-[2-(4-pentylcyclohexyl)ethyl]cyclohexyl]phenyl]ethyl]benzene |
| SMILES | CCCCCC1CCC(CCC2CCC(c3ccc(CCc4cc(F)c(Cl)c(F)c4)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C33H44ClF3/c1-2-3-4-5-23-6-8-24(9-7-23)10-11-25-12-15-27(16-13-25)29-19-18-28(30(35)22-29)17-14-26-20-31(36)33(34)32(37)21-26/h18-25,27H,2-17H2,1H3 |
| InChIKey | UZDKRUNSNDZIMX-UHFFFAOYSA-N |
| XLogP | 10.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.16 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|