C35H41ClF4 — CID 54017696
2-chloro-5-[2-[2,6-difluoro-4-[2-[4-(4-heptylphenyl)cyclohexyl]ethyl]phenyl]ethyl]-1,3-difluorobenzene (PubChem CID 54017696) has the molecular formula C35H41ClF4 and a molecular weight of 573.16 g/mol. Its IUPAC name is 2-chloro-5-[2-[2,6-difluoro-4-[2-[4-(4-heptylphenyl)cyclohexyl]ethyl]phenyl]ethyl]-1,3-difluorobenzene.
| Compound Name | 2-chloro-5-[2-[2,6-difluoro-4-[2-[4-(4-heptylphenyl)cyclohexyl]ethyl]phenyl]ethyl]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 54017696 |
| Molecular Formula | C35H41ClF4 |
| Molecular Weight | 573.16 g/mol |
| Exact Mass | 572.28 |
| IUPAC Name | 2-chloro-5-[2-[2,6-difluoro-4-[2-[4-(4-heptylphenyl)cyclohexyl]ethyl]phenyl]ethyl]-1,3-difluorobenzene |
| SMILES | CCCCCCCc1ccc(C2CCC(CCc3cc(F)c(CCc4cc(F)c(Cl)c(F)c4)c(F)c3)CC2)cc1 |
| InChI | InChI=1S/C35H41ClF4/c1-2-3-4-5-6-7-24-10-15-28(16-11-24)29-17-12-25(13-18-29)8-9-26-20-31(37)30(32(38)21-26)19-14-27-22-33(39)35(36)34(40)23-27/h10-11,15-16,20-23,25,29H,2-9,12-14,17-19H2,1H3 |
| InChIKey | KWSVFGDOZHUYPE-UHFFFAOYSA-N |
| XLogP | 11.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.16 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|