C30H32ClF3 — CID 54435292
5-[4-[2-[4-(4-butylphenyl)cyclohexyl]ethyl]-2-fluorophenyl]-2-chloro-1,3-difluorobenzene (PubChem CID 54435292) has the molecular formula C30H32ClF3 and a molecular weight of 485.03 g/mol. Its IUPAC name is 5-[4-[2-[4-(4-butylphenyl)cyclohexyl]ethyl]-2-fluorophenyl]-2-chloro-1,3-difluorobenzene.
| Compound Name | 5-[4-[2-[4-(4-butylphenyl)cyclohexyl]ethyl]-2-fluorophenyl]-2-chloro-1,3-difluorobenzene |
|---|---|
| PubChem CID | 54435292 |
| Molecular Formula | C30H32ClF3 |
| Molecular Weight | 485.03 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 5-[4-[2-[4-(4-butylphenyl)cyclohexyl]ethyl]-2-fluorophenyl]-2-chloro-1,3-difluorobenzene |
| SMILES | CCCCc1ccc(C2CCC(CCc3ccc(-c4cc(F)c(Cl)c(F)c4)c(F)c3)CC2)cc1 |
| InChI | InChI=1S/C30H32ClF3/c1-2-3-4-20-7-12-23(13-8-20)24-14-9-21(10-15-24)5-6-22-11-16-26(27(32)17-22)25-18-28(33)30(31)29(34)19-25/h7-8,11-13,16-19,21,24H,2-6,9-10,14-15H2,1H3 |
| InChIKey | WKHMPJLXPRHOKQ-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.03 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|