C28H28ClF3 — CID 54266929
2-chloro-5-[4-[2-[4-(4-ethylphenyl)cyclohexyl]ethyl]-2-fluorophenyl]-1,3-difluorobenzene (PubChem CID 54266929) has the molecular formula C28H28ClF3 and a molecular weight of 456.98 g/mol. Its IUPAC name is 2-chloro-5-[4-[2-[4-(4-ethylphenyl)cyclohexyl]ethyl]-2-fluorophenyl]-1,3-difluorobenzene.
| Compound Name | 2-chloro-5-[4-[2-[4-(4-ethylphenyl)cyclohexyl]ethyl]-2-fluorophenyl]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 54266929 |
| Molecular Formula | C28H28ClF3 |
| Molecular Weight | 456.98 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 2-chloro-5-[4-[2-[4-(4-ethylphenyl)cyclohexyl]ethyl]-2-fluorophenyl]-1,3-difluorobenzene |
| SMILES | CCc1ccc(C2CCC(CCc3ccc(-c4cc(F)c(Cl)c(F)c4)c(F)c3)CC2)cc1 |
| InChI | InChI=1S/C28H28ClF3/c1-2-18-5-10-21(11-6-18)22-12-7-19(8-13-22)3-4-20-9-14-24(25(30)15-20)23-16-26(31)28(29)27(32)17-23/h5-6,9-11,14-17,19,22H,2-4,7-8,12-13H2,1H3 |
| InChIKey | RHKJZVSQCGXISZ-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.98 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|