C32H43F — CID 67943668
2-fluoro-4-propyl-1-[4-[4-[(E)-2-(4-propylcyclohexyl)ethenyl]cyclohexyl]phenyl]benzene (PubChem CID 67943668) has the molecular formula C32H43F and a molecular weight of 446.69 g/mol. Its IUPAC name is 2-fluoro-4-propyl-1-[4-[4-[(E)-2-(4-propylcyclohexyl)ethenyl]cyclohexyl]phenyl]benzene.
| Compound Name | 2-fluoro-4-propyl-1-[4-[4-[(E)-2-(4-propylcyclohexyl)ethenyl]cyclohexyl]phenyl]benzene |
|---|---|
| PubChem CID | 67943668 |
| Molecular Formula | C32H43F |
| Molecular Weight | 446.69 g/mol |
| Exact Mass | 446.33 |
| IUPAC Name | 2-fluoro-4-propyl-1-[4-[4-[(E)-2-(4-propylcyclohexyl)ethenyl]cyclohexyl]phenyl]benzene |
| SMILES | CCCc1ccc(-c2ccc(C3CCC(/C=C/C4CCC(CCC)CC4)CC3)cc2)c(F)c1 |
| InChI | InChI=1S/C32H43F/c1-3-5-24-7-9-25(10-8-24)11-12-26-13-16-28(17-14-26)29-18-20-30(21-19-29)31-22-15-27(6-4-2)23-32(31)33/h11-12,15,18-26,28H,3-10,13-14,16-17H2,1-2H3/b12-11+ |
| InChIKey | GTIAKZMPXXYRJP-VAWYXSNFSA-N |
| XLogP | 9.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.69 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|