C24H28F4 — CID 54061362
2-fluoro-4-[2-(4-propylcyclohexyl)ethyl]-1-[4-(trifluoromethyl)phenyl]benzene (PubChem CID 54061362) has the molecular formula C24H28F4 and a molecular weight of 392.48 g/mol. Its IUPAC name is 2-fluoro-4-[2-(4-propylcyclohexyl)ethyl]-1-[4-(trifluoromethyl)phenyl]benzene.
| Compound Name | 2-fluoro-4-[2-(4-propylcyclohexyl)ethyl]-1-[4-(trifluoromethyl)phenyl]benzene |
|---|---|
| PubChem CID | 54061362 |
| Molecular Formula | C24H28F4 |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 2-fluoro-4-[2-(4-propylcyclohexyl)ethyl]-1-[4-(trifluoromethyl)phenyl]benzene |
| SMILES | CCCC1CCC(CCc2ccc(-c3ccc(C(F)(F)F)cc3)c(F)c2)CC1 |
| InChI | InChI=1S/C24H28F4/c1-2-3-17-4-6-18(7-5-17)8-9-19-10-15-22(23(25)16-19)20-11-13-21(14-12-20)24(26,27)28/h10-18H,2-9H2,1H3 |
| InChIKey | LZYHLOBUASLXMR-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |