C27H32F4 — CID 58839855
2-[2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]ethyl]-6-propyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 58839855) has the molecular formula C27H32F4 and a molecular weight of 432.55 g/mol. Its IUPAC name is 2-[2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]ethyl]-6-propyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-[2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]ethyl]-6-propyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 58839855 |
| Molecular Formula | C27H32F4 |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | 2-[2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]ethyl]-6-propyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCCC1CCC2CC(CCc3ccc(-c4cc(F)c(F)c(F)c4)c(F)c3)CCC2C1 |
| InChI | InChI=1S/C27H32F4/c1-2-3-17-6-9-21-13-18(7-10-20(21)12-17)4-5-19-8-11-23(24(28)14-19)22-15-25(29)27(31)26(30)16-22/h8,11,14-18,20-21H,2-7,9-10,12-13H2,1H3 |
| InChIKey | AYUWQNHNOXUKSF-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|