C21H22F4O — CID 58555817
2-[2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]ethyl]-5-propyloxolane (PubChem CID 58555817) has the molecular formula C21H22F4O and a molecular weight of 366.40 g/mol. Its IUPAC name is 2-[2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]ethyl]-5-propyloxolane.
| Compound Name | 2-[2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]ethyl]-5-propyloxolane |
|---|---|
| PubChem CID | 58555817 |
| Molecular Formula | C21H22F4O |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 2-[2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]ethyl]-5-propyloxolane |
| SMILES | CCCC1CCC(CCc2ccc(-c3cc(F)c(F)c(F)c3)c(F)c2)O1 |
| InChI | InChI=1S/C21H22F4O/c1-2-3-15-7-8-16(26-15)6-4-13-5-9-17(18(22)10-13)14-11-19(23)21(25)20(24)12-14/h5,9-12,15-16H,2-4,6-8H2,1H3 |
| InChIKey | XIJZKZHDTLBSHC-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|