C23H22F4 — CID 144658313
ethane;1,2,3-trifluoro-5-[2-fluoro-4-(4-propylphenyl)phenyl]benzene (PubChem CID 144658313) has the molecular formula C23H22F4 and a molecular weight of 374.42 g/mol. Its IUPAC name is ethane;1,2,3-trifluoro-5-[2-fluoro-4-(4-propylphenyl)phenyl]benzene.
| Compound Name | ethane;1,2,3-trifluoro-5-[2-fluoro-4-(4-propylphenyl)phenyl]benzene |
|---|---|
| PubChem CID | 144658313 |
| Molecular Formula | C23H22F4 |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | ethane;1,2,3-trifluoro-5-[2-fluoro-4-(4-propylphenyl)phenyl]benzene |
| SMILES | CC.CCCc1ccc(-c2ccc(-c3cc(F)c(F)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C21H16F4.C2H6/c1-2-3-13-4-6-14(7-5-13)15-8-9-17(18(22)10-15)16-11-19(23)21(25)20(24)12-16;1-2/h4-12H,2-3H2,1H3;1-2H3 |
| InChIKey | GADGLDVZGIXSAR-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|