C27H22F3N — CID 134427958
2,6-difluoro-4-[2-fluoro-4-[4-(4-propylphenyl)phenyl]phenyl]aniline (PubChem CID 134427958) has the molecular formula C27H22F3N and a molecular weight of 417.47 g/mol. Its IUPAC name is 2,6-difluoro-4-[2-fluoro-4-[4-(4-propylphenyl)phenyl]phenyl]aniline.
| Compound Name | 2,6-difluoro-4-[2-fluoro-4-[4-(4-propylphenyl)phenyl]phenyl]aniline |
|---|---|
| PubChem CID | 134427958 |
| Molecular Formula | C27H22F3N |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 2,6-difluoro-4-[2-fluoro-4-[4-(4-propylphenyl)phenyl]phenyl]aniline |
| SMILES | CCCc1ccc(-c2ccc(-c3ccc(-c4cc(F)c(N)c(F)c4)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C27H22F3N/c1-2-3-17-4-6-18(7-5-17)19-8-10-20(11-9-19)21-12-13-23(24(28)14-21)22-15-25(29)27(31)26(30)16-22/h4-16H,2-3,31H2,1H3 |
| InChIKey | NEHXUNHESPKDFV-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|