C28H20F6O — CID 90410644
1,3-difluoro-5-[2-fluoro-4-(4-propylphenyl)phenyl]-2-[(3,4,5-trifluorophenyl)methoxy]benzene (PubChem CID 90410644) has the molecular formula C28H20F6O and a molecular weight of 486.46 g/mol. Its IUPAC name is 1,3-difluoro-5-[2-fluoro-4-(4-propylphenyl)phenyl]-2-[(3,4,5-trifluorophenyl)methoxy]benzene.
| Compound Name | 1,3-difluoro-5-[2-fluoro-4-(4-propylphenyl)phenyl]-2-[(3,4,5-trifluorophenyl)methoxy]benzene |
|---|---|
| PubChem CID | 90410644 |
| Molecular Formula | C28H20F6O |
| Molecular Weight | 486.46 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | 1,3-difluoro-5-[2-fluoro-4-(4-propylphenyl)phenyl]-2-[(3,4,5-trifluorophenyl)methoxy]benzene |
| SMILES | CCCc1ccc(-c2ccc(-c3cc(F)c(OCc4cc(F)c(F)c(F)c4)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C28H20F6O/c1-2-3-16-4-6-18(7-5-16)19-8-9-21(22(29)12-19)20-13-25(32)28(26(33)14-20)35-15-17-10-23(30)27(34)24(31)11-17/h4-14H,2-3,15H2,1H3 |
| InChIKey | ZWBPHOAPHOLBTN-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.46 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|