C21H16F3I — CID 122546409
1,2-difluoro-5-[2-fluoro-4-(4-propylphenyl)phenyl]-3-iodobenzene (PubChem CID 122546409) has the molecular formula C21H16F3I and a molecular weight of 452.26 g/mol. Its IUPAC name is 1,2-difluoro-5-[2-fluoro-4-(4-propylphenyl)phenyl]-3-iodobenzene.
| Compound Name | 1,2-difluoro-5-[2-fluoro-4-(4-propylphenyl)phenyl]-3-iodobenzene |
|---|---|
| PubChem CID | 122546409 |
| Molecular Formula | C21H16F3I |
| Molecular Weight | 452.26 g/mol |
| Exact Mass | 452.02 |
| IUPAC Name | 1,2-difluoro-5-[2-fluoro-4-(4-propylphenyl)phenyl]-3-iodobenzene |
| SMILES | CCCc1ccc(-c2ccc(-c3cc(F)c(F)c(I)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C21H16F3I/c1-2-3-13-4-6-14(7-5-13)15-8-9-17(18(22)10-15)16-11-19(23)21(24)20(25)12-16/h4-12H,2-3H2,1H3 |
| InChIKey | MLIHFWAXUAIRPT-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.26 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|