C29H20F6 — CID 123579060
5-[4-[1,2-difluoro-2-[4-(4-propylphenyl)phenyl]ethenyl]-2-fluorophenyl]-1,2,3-trifluorobenzene (PubChem CID 123579060) has the molecular formula C29H20F6 and a molecular weight of 482.47 g/mol. Its IUPAC name is 5-[4-[1,2-difluoro-2-[4-(4-propylphenyl)phenyl]ethenyl]-2-fluorophenyl]-1,2,3-trifluorobenzene.
| Compound Name | 5-[4-[1,2-difluoro-2-[4-(4-propylphenyl)phenyl]ethenyl]-2-fluorophenyl]-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 123579060 |
| Molecular Formula | C29H20F6 |
| Molecular Weight | 482.47 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | 5-[4-[1,2-difluoro-2-[4-(4-propylphenyl)phenyl]ethenyl]-2-fluorophenyl]-1,2,3-trifluorobenzene |
| SMILES | CCCc1ccc(-c2ccc(C(F)=C(F)c3ccc(-c4cc(F)c(F)c(F)c4)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C29H20F6/c1-2-3-17-4-6-18(7-5-17)19-8-10-20(11-9-19)27(33)28(34)21-12-13-23(24(30)14-21)22-15-25(31)29(35)26(32)16-22/h4-16H,2-3H2,1H3 |
| InChIKey | CVSPQMOICCUXPT-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.47 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|