C23H16F6 — CID 123280656
5-[1,2-difluoro-2-[2-fluoro-4-(4-propylphenyl)phenyl]ethenyl]-1,2,3-trifluorobenzene (PubChem CID 123280656) has the molecular formula C23H16F6 and a molecular weight of 406.37 g/mol. Its IUPAC name is 5-[1,2-difluoro-2-[2-fluoro-4-(4-propylphenyl)phenyl]ethenyl]-1,2,3-trifluorobenzene.
| Compound Name | 5-[1,2-difluoro-2-[2-fluoro-4-(4-propylphenyl)phenyl]ethenyl]-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 123280656 |
| Molecular Formula | C23H16F6 |
| Molecular Weight | 406.37 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 5-[1,2-difluoro-2-[2-fluoro-4-(4-propylphenyl)phenyl]ethenyl]-1,2,3-trifluorobenzene |
| SMILES | CCCc1ccc(-c2ccc(C(F)=C(F)c3cc(F)c(F)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C23H16F6/c1-2-3-13-4-6-14(7-5-13)15-8-9-17(18(24)10-15)22(28)21(27)16-11-19(25)23(29)20(26)12-16/h4-12H,2-3H2,1H3 |
| InChIKey | RZWPBBWLNDXAPV-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.37 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|