C38H26F10O — CID 59328936
5-[[4-[(E)-1,2-difluoro-2-[2-fluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]ethenyl]-2-fluorophenyl]-difluoromethoxy]-1,2,3-trifluorobenzene (PubChem CID 59328936) has the molecular formula C38H26F10O and a molecular weight of 688.61 g/mol. Its IUPAC name is 5-[[4-[(E)-1,2-difluoro-2-[2-fluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]ethenyl]-2-fluorophenyl]-difluoromethoxy]-1,2,3-trifluorobenzene.
| Compound Name | 5-[[4-[(E)-1,2-difluoro-2-[2-fluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]ethenyl]-2-fluorophenyl]-difluoromethoxy]-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 59328936 |
| Molecular Formula | C38H26F10O |
| Molecular Weight | 688.61 g/mol |
| Exact Mass | 688.18 |
| IUPAC Name | 5-[[4-[(E)-1,2-difluoro-2-[2-fluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]ethenyl]-2-fluorophenyl]-difluoromethoxy]-1,2,3-trifluorobenzene |
| SMILES | CCCCCc1ccc(-c2ccc(-c3ccc(/C(F)=C(\F)c4ccc(C(F)(F)Oc5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C38H26F10O/c1-2-3-4-5-21-6-8-22(9-7-21)23-10-13-27(30(39)16-23)24-11-14-28(31(40)17-24)36(45)35(44)25-12-15-29(32(41)18-25)38(47,48)49-26-19-33(42)37(46)34(43)20-26/h6-20H,2-5H2,1H3/b36-35+ |
| InChIKey | MWFAQAJVSFOHQI-ULDVOPSXSA-N |
| XLogP | 12.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.61 |
| LogP ≤ 5 | 12.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|