C41H35F9O — CID 59327951
5-[4-(4-decylphenyl)-2-fluorophenyl]-2-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-1,3-difluorobenzene (PubChem CID 59327951) has the molecular formula C41H35F9O and a molecular weight of 714.71 g/mol. Its IUPAC name is 5-[4-(4-decylphenyl)-2-fluorophenyl]-2-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-1,3-difluorobenzene.
| Compound Name | 5-[4-(4-decylphenyl)-2-fluorophenyl]-2-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 59327951 |
| Molecular Formula | C41H35F9O |
| Molecular Weight | 714.71 g/mol |
| Exact Mass | 714.25 |
| IUPAC Name | 5-[4-(4-decylphenyl)-2-fluorophenyl]-2-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-1,3-difluorobenzene |
| SMILES | CCCCCCCCCCc1ccc(-c2ccc(-c3cc(F)c(C(F)(F)Oc4ccc(-c5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C41H35F9O/c1-2-3-4-5-6-7-8-9-10-25-11-13-26(14-12-25)27-15-17-31(33(42)19-27)28-20-35(44)39(36(45)21-28)41(49,50)51-30-16-18-32(34(43)24-30)29-22-37(46)40(48)38(47)23-29/h11-24H,2-10H2,1H3 |
| InChIKey | NSIAWFCCCCJAQW-UHFFFAOYSA-N |
| XLogP | 13.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.71 |
| LogP ≤ 5 | 13.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|