C36H26F8O — CID 59329629
2-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-1,3-difluoro-5-[4-(4-pentylphenyl)phenyl]benzene (PubChem CID 59329629) has the molecular formula C36H26F8O and a molecular weight of 626.59 g/mol. Its IUPAC name is 2-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-1,3-difluoro-5-[4-(4-pentylphenyl)phenyl]benzene.
| Compound Name | 2-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-1,3-difluoro-5-[4-(4-pentylphenyl)phenyl]benzene |
|---|---|
| PubChem CID | 59329629 |
| Molecular Formula | C36H26F8O |
| Molecular Weight | 626.59 g/mol |
| Exact Mass | 626.19 |
| IUPAC Name | 2-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-1,3-difluoro-5-[4-(4-pentylphenyl)phenyl]benzene |
| SMILES | CCCCCc1ccc(-c2ccc(-c3cc(F)c(C(F)(F)Oc4ccc(-c5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C36H26F8O/c1-2-3-4-5-21-6-8-22(9-7-21)23-10-12-24(13-11-23)25-16-30(38)34(31(39)17-25)36(43,44)45-27-14-15-28(29(37)20-27)26-18-32(40)35(42)33(41)19-26/h6-20H,2-5H2,1H3 |
| InChIKey | XICFSCMBIRVVGP-UHFFFAOYSA-N |
| XLogP | 11.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.59 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|