C38H28F10O — CID 59328905
2-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-5-[2,6-difluoro-4-(4-heptylphenyl)phenyl]-1,3-difluorobenzene (PubChem CID 59328905) has the molecular formula C38H28F10O and a molecular weight of 690.62 g/mol. Its IUPAC name is 2-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-5-[2,6-difluoro-4-(4-heptylphenyl)phenyl]-1,3-difluorobenzene.
| Compound Name | 2-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-5-[2,6-difluoro-4-(4-heptylphenyl)phenyl]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 59328905 |
| Molecular Formula | C38H28F10O |
| Molecular Weight | 690.62 g/mol |
| Exact Mass | 690.20 |
| IUPAC Name | 2-[difluoro-[3-fluoro-4-(3,4,5-trifluorophenyl)phenoxy]methyl]-5-[2,6-difluoro-4-(4-heptylphenyl)phenyl]-1,3-difluorobenzene |
| SMILES | CCCCCCCc1ccc(-c2cc(F)c(-c3cc(F)c(C(F)(F)Oc4ccc(-c5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C38H28F10O/c1-2-3-4-5-6-7-21-8-10-22(11-9-21)23-14-29(40)35(30(41)15-23)25-18-31(42)36(32(43)19-25)38(47,48)49-26-12-13-27(28(39)20-26)24-16-33(44)37(46)34(45)17-24/h8-20H,2-7H2,1H3 |
| InChIKey | ZFGDRUZQKDWBSS-UHFFFAOYSA-N |
| XLogP | 12.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.62 |
| LogP ≤ 5 | 12.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|