C31H24F8O2 — CID 175685533
2-[difluoro-[4-(trifluoromethoxy)phenoxy]methyl]-1,3-difluoro-5-[2-fluoro-4-(4-pentylphenyl)phenyl]benzene (PubChem CID 175685533) has the molecular formula C31H24F8O2 and a molecular weight of 580.52 g/mol. Its IUPAC name is 2-[difluoro-[4-(trifluoromethoxy)phenoxy]methyl]-1,3-difluoro-5-[2-fluoro-4-(4-pentylphenyl)phenyl]benzene.
| Compound Name | 2-[difluoro-[4-(trifluoromethoxy)phenoxy]methyl]-1,3-difluoro-5-[2-fluoro-4-(4-pentylphenyl)phenyl]benzene |
|---|---|
| PubChem CID | 175685533 |
| Molecular Formula | C31H24F8O2 |
| Molecular Weight | 580.52 g/mol |
| Exact Mass | 580.16 |
| IUPAC Name | 2-[difluoro-[4-(trifluoromethoxy)phenoxy]methyl]-1,3-difluoro-5-[2-fluoro-4-(4-pentylphenyl)phenyl]benzene |
| SMILES | CCCCCc1ccc(-c2ccc(-c3cc(F)c(C(F)(F)Oc4ccc(OC(F)(F)F)cc4)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C31H24F8O2/c1-2-3-4-5-19-6-8-20(9-7-19)21-10-15-25(26(32)16-21)22-17-27(33)29(28(34)18-22)30(35,36)40-23-11-13-24(14-12-23)41-31(37,38)39/h6-18H,2-5H2,1H3 |
| InChIKey | NPAPUMRBTZNJTN-UHFFFAOYSA-N |
| XLogP | 10.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.52 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|