C36H25ClF8O — CID 59329393
2-chloro-5-[[2,6-difluoro-4-[2-fluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]phenyl]-difluoromethoxy]-1,3-difluorobenzene (PubChem CID 59329393) has the molecular formula C36H25ClF8O and a molecular weight of 661.03 g/mol. Its IUPAC name is 2-chloro-5-[[2,6-difluoro-4-[2-fluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]phenyl]-difluoromethoxy]-1,3-difluorobenzene.
| Compound Name | 2-chloro-5-[[2,6-difluoro-4-[2-fluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]phenyl]-difluoromethoxy]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 59329393 |
| Molecular Formula | C36H25ClF8O |
| Molecular Weight | 661.03 g/mol |
| Exact Mass | 660.15 |
| IUPAC Name | 2-chloro-5-[[2,6-difluoro-4-[2-fluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]phenyl]-difluoromethoxy]-1,3-difluorobenzene |
| SMILES | CCCCCc1ccc(-c2ccc(-c3ccc(-c4cc(F)c(C(F)(F)Oc5cc(F)c(Cl)c(F)c5)c(F)c4)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C36H25ClF8O/c1-2-3-4-5-20-6-8-21(9-7-20)22-10-12-26(28(38)14-22)23-11-13-27(29(39)15-23)24-16-30(40)34(31(41)17-24)36(44,45)46-25-18-32(42)35(37)33(43)19-25/h6-19H,2-5H2,1H3 |
| InChIKey | JADZNIAFWNYXMD-UHFFFAOYSA-N |
| XLogP | 12.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.03 |
| LogP ≤ 5 | 12.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|