C36H26ClF7O — CID 59328744
2-chloro-5-[difluoro-[2-fluoro-4-[2-fluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]phenyl]methoxy]-1,3-difluorobenzene (PubChem CID 59328744) has the molecular formula C36H26ClF7O and a molecular weight of 643.04 g/mol. Its IUPAC name is 2-chloro-5-[difluoro-[2-fluoro-4-[2-fluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]phenyl]methoxy]-1,3-difluorobenzene.
| Compound Name | 2-chloro-5-[difluoro-[2-fluoro-4-[2-fluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]phenyl]methoxy]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 59328744 |
| Molecular Formula | C36H26ClF7O |
| Molecular Weight | 643.04 g/mol |
| Exact Mass | 642.16 |
| IUPAC Name | 2-chloro-5-[difluoro-[2-fluoro-4-[2-fluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]phenyl]methoxy]-1,3-difluorobenzene |
| SMILES | CCCCCc1ccc(-c2ccc(-c3ccc(-c4ccc(C(F)(F)Oc5cc(F)c(Cl)c(F)c5)c(F)c4)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C36H26ClF7O/c1-2-3-4-5-21-6-8-22(9-7-21)23-10-13-27(30(38)16-23)24-11-14-28(31(39)17-24)25-12-15-29(32(40)18-25)36(43,44)45-26-19-33(41)35(37)34(42)20-26/h6-20H,2-5H2,1H3 |
| InChIKey | KKDOADXHGMTOSM-UHFFFAOYSA-N |
| XLogP | 11.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.04 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|