C23H19F5 — CID 18513410
1,2,3-trifluoro-5-[2-fluoro-4-[2-(2-fluoro-4-propylphenyl)ethyl]phenyl]benzene (PubChem CID 18513410) has the molecular formula C23H19F5 and a molecular weight of 390.40 g/mol. Its IUPAC name is 1,2,3-trifluoro-5-[2-fluoro-4-[2-(2-fluoro-4-propylphenyl)ethyl]phenyl]benzene.
| Compound Name | 1,2,3-trifluoro-5-[2-fluoro-4-[2-(2-fluoro-4-propylphenyl)ethyl]phenyl]benzene |
|---|---|
| PubChem CID | 18513410 |
| Molecular Formula | C23H19F5 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 1,2,3-trifluoro-5-[2-fluoro-4-[2-(2-fluoro-4-propylphenyl)ethyl]phenyl]benzene |
| SMILES | CCCc1ccc(CCc2ccc(-c3cc(F)c(F)c(F)c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C23H19F5/c1-2-3-14-4-7-16(19(24)10-14)8-5-15-6-9-18(20(25)11-15)17-12-21(26)23(28)22(27)13-17/h4,6-7,9-13H,2-3,5,8H2,1H3 |
| InChIKey | PDXFTRLPSLHGRE-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|