C17H19FO — CID 134432733
2-[4-(2-fluoro-4-propylphenyl)phenyl]ethanol (PubChem CID 134432733) has the molecular formula C17H19FO and a molecular weight of 258.34 g/mol. Its IUPAC name is 2-[4-(2-fluoro-4-propylphenyl)phenyl]ethanol.
| Compound Name | 2-[4-(2-fluoro-4-propylphenyl)phenyl]ethanol |
|---|---|
| PubChem CID | 134432733 |
| Molecular Formula | C17H19FO |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 2-[4-(2-fluoro-4-propylphenyl)phenyl]ethanol |
| SMILES | CCCc1ccc(-c2ccc(CCO)cc2)c(F)c1 |
| InChI | InChI=1S/C17H19FO/c1-2-3-14-6-9-16(17(18)12-14)15-7-4-13(5-8-15)10-11-19/h4-9,12,19H,2-3,10-11H2,1H3 |
| InChIKey | IFONRWMELZDQMU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |