About ethane;2-fluoro-4-(3-methoxybut-3-enyl)-1-(4-propylphenyl)benzene;hydrogen peroxide
ethane;2-fluoro-4-(3-methoxybut-3-enyl)-1-(4-propylphenyl)benzene;hydrogen peroxide (PubChem CID 144914338) has the molecular formula C24H37FO3
and a molecular weight of 392.56 g/mol. Its IUPAC name is ethane;2-fluoro-4-(3-methoxybut-3-enyl)-1-(4-propylphenyl)benzene;hydrogen peroxide.
Molecular Properties
| Compound Name | ethane;2-fluoro-4-(3-methoxybut-3-enyl)-1-(4-propylphenyl)benzene;hydrogen peroxide |
| PubChem CID | 144914338 |
| Molecular Formula | C24H37FO3 |
| Molecular Weight | 392.56 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | ethane;2-fluoro-4-(3-methoxybut-3-enyl)-1-(4-propylphenyl)benzene;hydrogen peroxide |
| SMILES | C=C(CCc1ccc(-c2ccc(CCC)cc2)c(F)c1)OC.CC.CC.OO |
| InChI | InChI=1S/C20H23FO.2C2H6.H2O2/c1-4-5-16-8-11-18(12-9-16)19-13-10-17(14-20(19)21)7-6-15(2)22-3;3*1-2/h8-14H,2,4-7H2,1,3H3;2*1-2H3;1-2H |
| InChIKey | YUQHXISKJIMNQE-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.56 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-fluoro-4-(3-methoxybut-3-enyl)-1-(4-propylphenyl)benzene;hydrogen peroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-fluoro-4-(3-methoxybut-3-enyl)-1-(4-propylphenyl)benzene;hydrogen peroxide?
The IUPAC name of ethane;2-fluoro-4-(3-methoxybut-3-enyl)-1-(4-propylphenyl)benzene;hydrogen peroxide (CID 144914338) is ethane;2-fluoro-4-(3-methoxybut-3-enyl)-1-(4-propylphenyl)benzene;hydrogen peroxide.
What is the SMILES notation for ethane;2-fluoro-4-(3-methoxybut-3-enyl)-1-(4-propylphenyl)benzene;hydrogen peroxide?
The canonical SMILES for ethane;2-fluoro-4-(3-methoxybut-3-enyl)-1-(4-propylphenyl)benzene;hydrogen peroxide is C=C(CCc1ccc(-c2ccc(CCC)cc2)c(F)c1)OC.CC.CC.OO.
What is the InChIKey of ethane;2-fluoro-4-(3-methoxybut-3-enyl)-1-(4-propylphenyl)benzene;hydrogen peroxide?
The InChIKey is YUQHXISKJIMNQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23FO.2C2H6.H2O2/c1-4-5-16-8-11-18(12-9-16)19-13-10-17(14-20(19)21)7-6-15(2)22-3;3*1-2/h8-14H,2,4-7H2,1,3H3;2*1-2H3;1-2H.
What are the key properties of ethane;2-fluoro-4-(3-methoxybut-3-enyl)-1-(4-propylphenyl)benzene;hydrogen peroxide?
ethane;2-fluoro-4-(3-methoxybut-3-enyl)-1-(4-propylphenyl)benzene;hydrogen peroxide has a molecular weight of 392.56 g/mol, XLogP of 7.61, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-fluoro-4-(3-methoxybut-3-enyl)-1-(4-propylphenyl)benzene;hydrogen peroxide is sourced from PubChem (CID 144914338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).