C19H21FO3 — CID 134244927
1-[4-(2-fluoro-4-propylphenyl)phenoxy]-2-methylidenepropane-1,3-diol (PubChem CID 134244927) has the molecular formula C19H21FO3 and a molecular weight of 316.37 g/mol. Its IUPAC name is 1-[4-(2-fluoro-4-propylphenyl)phenoxy]-2-methylidenepropane-1,3-diol.
| Compound Name | 1-[4-(2-fluoro-4-propylphenyl)phenoxy]-2-methylidenepropane-1,3-diol |
|---|---|
| PubChem CID | 134244927 |
| Molecular Formula | C19H21FO3 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 1-[4-(2-fluoro-4-propylphenyl)phenoxy]-2-methylidenepropane-1,3-diol |
| SMILES | C=C(CO)C(O)Oc1ccc(-c2ccc(CCC)cc2F)cc1 |
| InChI | InChI=1S/C19H21FO3/c1-3-4-14-5-10-17(18(20)11-14)15-6-8-16(9-7-15)23-19(22)13(2)12-21/h5-11,19,21-22H,2-4,12H2,1H3 |
| InChIKey | GFWVRTQGRZRCQL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|