C28H31FO3 — CID 146207400
1-[4-[2-[4-[2-ethyl-4-(2-hydroxyethyl)phenyl]-3-fluorophenyl]ethyl]phenoxy]-2-methylprop-2-en-1-ol (PubChem CID 146207400) has the molecular formula C28H31FO3 and a molecular weight of 434.55 g/mol. Its IUPAC name is 1-[4-[2-[4-[2-ethyl-4-(2-hydroxyethyl)phenyl]-3-fluorophenyl]ethyl]phenoxy]-2-methylprop-2-en-1-ol.
| Compound Name | 1-[4-[2-[4-[2-ethyl-4-(2-hydroxyethyl)phenyl]-3-fluorophenyl]ethyl]phenoxy]-2-methylprop-2-en-1-ol |
|---|---|
| PubChem CID | 146207400 |
| Molecular Formula | C28H31FO3 |
| Molecular Weight | 434.55 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 1-[4-[2-[4-[2-ethyl-4-(2-hydroxyethyl)phenyl]-3-fluorophenyl]ethyl]phenoxy]-2-methylprop-2-en-1-ol |
| SMILES | C=C(C)C(O)Oc1ccc(CCc2ccc(-c3ccc(CCO)cc3CC)c(F)c2)cc1 |
| InChI | InChI=1S/C28H31FO3/c1-4-23-17-22(15-16-30)9-13-25(23)26-14-10-21(18-27(26)29)6-5-20-7-11-24(12-8-20)32-28(31)19(2)3/h7-14,17-18,28,30-31H,2,4-6,15-16H2,1,3H3 |
| InChIKey | UNAQVORWUMVNBM-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.55 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|