C33H39FO5 — CID 118699982
2-[4-[4-[4-[3,3-bis(hydroxymethyl)pentyl]-2-ethylphenyl]-3-fluorophenyl]phenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 118699982) has the molecular formula C33H39FO5 and a molecular weight of 534.67 g/mol. Its IUPAC name is 2-[4-[4-[4-[3,3-bis(hydroxymethyl)pentyl]-2-ethylphenyl]-3-fluorophenyl]phenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-[4-[4-[3,3-bis(hydroxymethyl)pentyl]-2-ethylphenyl]-3-fluorophenyl]phenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118699982 |
| Molecular Formula | C33H39FO5 |
| Molecular Weight | 534.67 g/mol |
| Exact Mass | 534.28 |
| IUPAC Name | 2-[4-[4-[4-[3,3-bis(hydroxymethyl)pentyl]-2-ethylphenyl]-3-fluorophenyl]phenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1ccc(-c2ccc(-c3ccc(CCC(CC)(CO)CO)cc3CC)c(F)c2)cc1 |
| InChI | InChI=1S/C33H39FO5/c1-5-25-19-24(15-16-33(6-2,21-35)22-36)7-13-29(25)30-14-10-27(20-31(30)34)26-8-11-28(12-9-26)38-17-18-39-32(37)23(3)4/h7-14,19-20,35-36H,3,5-6,15-18,21-22H2,1-2,4H3 |
| InChIKey | KAZUCOZVDCWOLT-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.67 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|