C24H21FO3 — CID 67641327
2-[4-(3-fluoro-4-phenylphenyl)phenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 67641327) has the molecular formula C24H21FO3 and a molecular weight of 376.43 g/mol. Its IUPAC name is 2-[4-(3-fluoro-4-phenylphenyl)phenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-(3-fluoro-4-phenylphenyl)phenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 67641327 |
| Molecular Formula | C24H21FO3 |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 2-[4-(3-fluoro-4-phenylphenyl)phenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1ccc(-c2ccc(-c3ccccc3)c(F)c2)cc1 |
| InChI | InChI=1S/C24H21FO3/c1-17(2)24(26)28-15-14-27-21-11-8-18(9-12-21)20-10-13-22(23(25)16-20)19-6-4-3-5-7-19/h3-13,16H,1,14-15H2,2H3 |
| InChIKey | NEFDVNURYACGRW-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|