C26H25FO4 — CID 134200656
2-[5-[2-fluoro-4-(4-methylphenyl)phenyl]-2-(hydroxymethyl)phenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 134200656) has the molecular formula C26H25FO4 and a molecular weight of 420.48 g/mol. Its IUPAC name is 2-[5-[2-fluoro-4-(4-methylphenyl)phenyl]-2-(hydroxymethyl)phenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[5-[2-fluoro-4-(4-methylphenyl)phenyl]-2-(hydroxymethyl)phenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134200656 |
| Molecular Formula | C26H25FO4 |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 2-[5-[2-fluoro-4-(4-methylphenyl)phenyl]-2-(hydroxymethyl)phenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1cc(-c2ccc(-c3ccc(C)cc3)cc2F)ccc1CO |
| InChI | InChI=1S/C26H25FO4/c1-17(2)26(29)31-13-12-30-25-15-21(8-9-22(25)16-28)23-11-10-20(14-24(23)27)19-6-4-18(3)5-7-19/h4-11,14-15,28H,1,12-13,16H2,2-3H3 |
| InChIKey | HODDCLFSNLPNSU-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|