C25H23FO3 — CID 145122358
[5-[2-fluoro-4-(4-methylphenyl)phenyl]-2-(hydroxymethyl)phenyl]methyl 2-methylprop-2-enoate (PubChem CID 145122358) has the molecular formula C25H23FO3 and a molecular weight of 390.45 g/mol. Its IUPAC name is [5-[2-fluoro-4-(4-methylphenyl)phenyl]-2-(hydroxymethyl)phenyl]methyl 2-methylprop-2-enoate.
| Compound Name | [5-[2-fluoro-4-(4-methylphenyl)phenyl]-2-(hydroxymethyl)phenyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 145122358 |
| Molecular Formula | C25H23FO3 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | [5-[2-fluoro-4-(4-methylphenyl)phenyl]-2-(hydroxymethyl)phenyl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCc1cc(-c2ccc(-c3ccc(C)cc3)cc2F)ccc1CO |
| InChI | InChI=1S/C25H23FO3/c1-16(2)25(28)29-15-22-12-20(8-9-21(22)14-27)23-11-10-19(13-24(23)26)18-6-4-17(3)5-7-18/h4-13,27H,1,14-15H2,2-3H3 |
| InChIKey | ABWMAFOYPSOCCW-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|