C26H23F3O3 — CID 134200827
[5-[2,6-difluoro-4-(2-fluorophenyl)phenyl]-2-(3-hydroxypropyl)phenyl]methyl 2-methylprop-2-enoate (PubChem CID 134200827) has the molecular formula C26H23F3O3 and a molecular weight of 440.46 g/mol. Its IUPAC name is [5-[2,6-difluoro-4-(2-fluorophenyl)phenyl]-2-(3-hydroxypropyl)phenyl]methyl 2-methylprop-2-enoate.
| Compound Name | [5-[2,6-difluoro-4-(2-fluorophenyl)phenyl]-2-(3-hydroxypropyl)phenyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134200827 |
| Molecular Formula | C26H23F3O3 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | [5-[2,6-difluoro-4-(2-fluorophenyl)phenyl]-2-(3-hydroxypropyl)phenyl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCc1cc(-c2c(F)cc(-c3ccccc3F)cc2F)ccc1CCCO |
| InChI | InChI=1S/C26H23F3O3/c1-16(2)26(31)32-15-20-12-18(10-9-17(20)6-5-11-30)25-23(28)13-19(14-24(25)29)21-7-3-4-8-22(21)27/h3-4,7-10,12-14,30H,1,5-6,11,15H2,2H3 |
| InChIKey | GPBGDMDTTJXUQL-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|